Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-acetyl-D-glucosamine N-acetyl-D-glucosamine] == * common name: ** N-acetyl-D-glucosamine * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == |
+ | * smiles: | ||
+ | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8)))) | ||
* common name: | * common name: | ||
− | ** | + | ** Mg-protoporphyrin |
+ | * molecular weight: | ||
+ | ** 582.94 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Mg-protoporphyrin IX |
− | + | ** magnesium protoporphyrin | |
− | ** | + | ** MgP |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-20]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516] | ||
+ | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}} | ||
+ | {{#set: common name=Mg-protoporphyrin}} | ||
+ | {{#set: molecular weight=582.94 }} | ||
+ | {{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}} | ||
+ | {{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}} | ||
+ | {{#set: produced by=RXN1F-20}} |
Revision as of 22:06, 17 March 2018
Contents
Metabolite MG-PROTOPORPHYRIN
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
- common name:
- Mg-protoporphyrin
- molecular weight:
- 582.94
- Synonym(s):
- Mg-protoporphyrin IX
- magnesium protoporphyrin
- MgP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))" cannot be used as a page name in this wiki.