Difference between revisions of "RXN-2043"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** densipoloyl-CoA |
| + | * molecular weight: | ||
| + | ** 1041.936 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | * [[RXN-16150]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551] |
| − | {{#set: | + | {{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}} |
| − | {{#set: | + | {{#set: common name=densipoloyl-CoA}} |
| + | {{#set: molecular weight=1041.936 }} | ||
| + | {{#set: reversible reaction associated=RXN-16150}} | ||
Revision as of 20:37, 17 March 2018
Contents
Metabolite CPD-15365
- smiles:
- CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
- common name:
- densipoloyl-CoA
- molecular weight:
- 1041.936
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
