Difference between revisions of "CPD-7649"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** L- | + | ** 2-carboxy-L-xylonolactone |
| + | * molecular weight: | ||
| + | ** 191.117 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-12871]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-12870]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445] |
| − | {{#set: common name=L- | + | {{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=2-carboxy-L-xylonolactone}} |
| − | {{#set: | + | {{#set: molecular weight=191.117 }} |
| + | {{#set: consumed by=RXN-12871}} | ||
| + | {{#set: produced by=RXN-12870}} | ||
Revision as of 20:40, 17 March 2018
Contents
Metabolite CPD-13913
- smiles:
- C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
- inchi key:
- InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
- common name:
- 2-carboxy-L-xylonolactone
- molecular weight:
- 191.117
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.
