Difference between revisions of "PWY-5366"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M |
* common name: | * common name: | ||
| − | ** S- | + | ** 9(S)-HPOTE |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 309.425 |
* Synonym(s): | * Synonym(s): | ||
| − | ** S- | + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid |
| + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8497]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321] |
| − | + | {{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=9(S)-HPOTE}} |
| − | {{#set: common name=S- | + | {{#set: molecular weight=309.425 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}} |
| − | {{#set: common name=S- | + | {{#set: produced by=RXN-8497}} |
| − | {{#set: | + | |
Revision as of 20:33, 17 March 2018
Contents
Metabolite CPD-8678
- smiles:
- CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
- inchi key:
- InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
- common name:
- 9(S)-HPOTE
- molecular weight:
- 309.425
- Synonym(s):
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.
