Difference between revisions of "RXN66-313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C |
| − | ** | + | * inchi key: |
| + | ** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol |
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-14]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) | + | * [[RXN66-13]] |
| − | * [ | + | * [[RXN-13707]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}} |
| − | {{#set: | + | {{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}} |
| − | {{#set: | + | {{#set: molecular weight=412.698 }} |
| + | {{#set: consumed by=RXN66-14}} | ||
| + | {{#set: produced by=RXN66-13|RXN-13707}} | ||
Revision as of 21:04, 17 March 2018
Contents
Metabolite CPD-8609
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
- inchi key:
- InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
- common name:
- 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.
