Difference between revisions of "Ec-00 003690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == |
− | * | + | * smiles: |
− | ** [ | + | ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) |
− | ** | + | * inchi key: |
+ | ** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** dehydroascorbate (bicyclic form) |
+ | * molecular weight: | ||
+ | ** 192.125 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dehydroascorbate monohydrate |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12861]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12862]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | * [ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000] |
− | {{#set: common name= | + | {{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}} |
− | {{#set: | + | {{#set: common name=dehydroascorbate (bicyclic form)}} |
− | {{#set: | + | {{#set: molecular weight=192.125 }} |
− | {{#set: | + | {{#set: common name=dehydroascorbate monohydrate}} |
+ | {{#set: consumed by=RXN-12861}} | ||
+ | {{#set: produced by=RXN-12862}} |
Revision as of 22:08, 17 March 2018
Contents
Metabolite CPD-13907
- smiles:
- C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
- inchi key:
- InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
- common name:
- dehydroascorbate (bicyclic form)
- molecular weight:
- 192.125
- Synonym(s):
- dehydroascorbate monohydrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))" cannot be used as a page name in this wiki.