Difference between revisions of "PWY3O-355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] ==
* smiles:
+
* taxonomic range:
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
** isobutanoyl-CoA
+
** D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis
* molecular weight:
+
** 833.593   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-methylpropanoyl-CoA
 
** isobutyryl-coenzyme A
 
** 2-methylpropionyl-CoA
 
** S-(2-methylpropanoyl)-CoA
 
** isobutyryl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[MEPROPCOA-FAD-RXN]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.133-RXN]]
* [[1.2.1.25-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-05_003010]]
* [[2.3.1.168-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[2.7.1.140-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10945 RXN-10945]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7162 RXN-7162]
 
== External links  ==
 
== External links  ==
* CAS : 15621-60-0
+
{{#set: taxonomic range=TAX-2759}}
* PUBCHEM:
+
{{#set: common name=D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266570 45266570]
+
{{#set: reaction found=2}}
* HMDB : HMDB01243
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00630 C00630]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57338 57338]
+
* METABOLIGHTS : MTBLC57338
+
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: inchi key=InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J}}
+
{{#set: common name=isobutanoyl-CoA}}
+
{{#set: molecular weight=833.593    }}
+
{{#set: common name=2-methylpropanoyl-CoA|isobutyryl-coenzyme A|2-methylpropionyl-CoA|S-(2-methylpropanoyl)-CoA|isobutyryl-CoA}}
+
{{#set: consumed by=MEPROPCOA-FAD-RXN}}
+
{{#set: produced by=1.2.1.25-RXN}}
+
{{#set: consumed or produced by=2.3.1.168-RXN}}
+

Revision as of 20:34, 17 March 2018

Pathway PWY-6366

  • taxonomic range:
  • common name:
    • D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links