Difference between revisions of "Ec-27 004040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHITOBIOSE CHITOBIOSE] == * common name: ** N,N'-diacetylchitobiose * Synonym(s): ** diacetylch...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHITOBIOSE CHITOBIOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
 +
* smiles:
 +
** CC1(OC(C(C(C1O)O)O)O)
 +
* inchi key:
 +
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
 
* common name:
 
* common name:
** N,N'-diacetylchitobiose
+
** β-L-fucopyranose
 +
* molecular weight:
 +
** 164.158   
 
* Synonym(s):
 
* Synonym(s):
** diacetylchitobiose
+
** β-L-fucose
** N-[2-[5-acetylamino-4,6-dihydroxy-2-(hydroxymethyl)tetrahydropyran-3-yl]oxy-4,5-dihyrdoxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
+
** CBS
+
** chitobiose
+
** 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-β-D-glucopyranose
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12625]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12623]]
 
* [[RXN-12554]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-5298]]
 
== External links  ==
 
== External links  ==
{{#set: common name=N,N'-diacetylchitobiose}}
+
* DRUGBANK : DB03283
{{#set: common name=diacetylchitobiose|N-[2-[5-acetylamino-4,6-dihydroxy-2-(hydroxymethyl)tetrahydropyran-3-yl]oxy-4,5-dihyrdoxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide|CBS|chitobiose|2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-β-D-glucopyranose}}
+
* PUBCHEM:
{{#set: consumed by=RXN-12625}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
{{#set: produced by=RXN-12623|RXN-12554}}
+
* HMDB : HMDB59625
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
 +
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
 +
{{#set: common name=β-L-fucopyranose}}
 +
{{#set: molecular weight=164.158    }}
 +
{{#set: common name=β-L-fucose}}
 +
{{#set: reversible reaction associated=RXN0-5298}}

Revision as of 13:10, 21 March 2018

Metabolite CPD0-1107

  • smiles:
    • CC1(OC(C(C(C1O)O)O)O)
  • inchi key:
    • InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
  • common name:
    • β-L-fucopyranose
  • molecular weight:
    • 164.158
  • Synonym(s):
    • β-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links