Difference between revisions of "Ec-08 003110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5794 TAX-57...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5794 TAX-5794]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
−
** InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** xanthosine
+
** methylerythritol phosphate pathway II
−
* molecular weight:
+
−
** 284.228   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 9 β-D-ribofuranosylxanthine
+
** nonmevalonate isopentenyl diphosphate biosynthesis
 +
** methylerythritol phosphate degradation
 +
** MEP degradation
 +
** deoxyxylulose phosphate pathway
 +
** DOXP pathway
 +
** Rohmer pathway
 +
** isopentenyl diphosphate biosynthesis -- mevalonate-independent
 +
** nonmevalonate isoprenoid pathway
 +
** MEP pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
* [[XMPXAN-RXN]]
+
* [[2.7.1.148-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-10_001370]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[2.7.7.60-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_008050]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DXPREDISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_007940]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DXS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-15_004230]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-11_001030]]
 +
*** [[Ec-18_002690]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ISPH2-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_002680]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN0-302]]
 +
** 1 associated gene(s):
 +
*** [[Ec-25_000990]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-882]]
 +
** 1 associated gene(s):
 +
*** [[Ec-03_003610]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-884]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_002680]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 146-80-5
+
{{#set: taxonomic range=TAX-5794}}
−
* BIGG : 38352
+
{{#set: taxonomic range=TAX-1117}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=64959 64959]
+
{{#set: common name=methylerythritol phosphate pathway II}}
−
* HMDB : HMDB00299
+
{{#set: common name=nonmevalonate isopentenyl diphosphate biosynthesis|methylerythritol phosphate degradation|MEP degradation|deoxyxylulose phosphate pathway|DOXP pathway|Rohmer pathway|isopentenyl diphosphate biosynthesis -- mevalonate-independent|nonmevalonate isoprenoid pathway|MEP pathway}}
−
* LIGAND-CPD:
+
{{#set: reaction found=9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01762 C01762]
+
{{#set: total reaction=9}}
−
* CHEMSPIDER:
+
{{#set: completion rate=100.0}}
−
** [http://www.chemspider.com/Chemical-Structure.1152.html 1152]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18107 18107]
+
−
* METABOLIGHTS : MTBLC18107
+
−
{{#set: smiles=C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
−
{{#set: inchi key=InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N}}
+
−
{{#set: common name=xanthosine}}
+
−
{{#set: molecular weight=284.228    }}
+
−
{{#set: common name=9 β-D-ribofuranosylxanthine}}
+
−
{{#set: produced by=XMPXAN-RXN}}
+

Revision as of 13:11, 21 March 2018

Pathway PWY-7560

  • taxonomic range:
  • common name:
    • methylerythritol phosphate pathway II
  • Synonym(s):
    • nonmevalonate isopentenyl diphosphate biosynthesis
    • methylerythritol phosphate degradation
    • MEP degradation
    • deoxyxylulose phosphate pathway
    • DOXP pathway
    • Rohmer pathway
    • isopentenyl diphosphate biosynthesis -- mevalonate-independent
    • nonmevalonate isoprenoid pathway
    • MEP pathway

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_003110&oldid=16316"