Difference between revisions of "PWY-3722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == * smiles: ** C(C1(C(=CC=CC=1)NC=O))=O * inchi key: ** InChIKey=PVIMSPYDDGDC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-275...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] ==
* smiles:
+
* taxonomic range:
** C(C1(C(=CC=CC=1)NC=O))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 2-formylaminobenzaldehyde
+
** L-leucine degradation I
* molecular weight:
+
** 149.149   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''6''' reactions in the full pathway
* [[INDOLE-23-DIOXYGENASE-RXN]]
+
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_005560]]
 +
*** [[Ec-20_001390]]
 +
*** [[Ec-12_005530]]
 +
*** [[Ec-12_005520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-26_006120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-22_002400]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-2301]]
 +
** 1 associated gene(s):
 +
*** [[Ec-14_006780]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=400 400]
+
{{#set: taxonomic range=TAX-2}}
* CHEMSPIDER:
+
{{#set: common name=L-leucine degradation I}}
** [http://www.chemspider.com/Chemical-Structure.389.html 389]
+
{{#set: reaction found=6}}
* CHEBI:
+
{{#set: total reaction=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18033 18033]
+
{{#set: completion rate=100.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03574 C03574]
+
{{#set: smiles=C(C1(C(=CC=CC=1)NC=O))=O}}
+
{{#set: inchi key=InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N}}
+
{{#set: common name=2-formylaminobenzaldehyde}}
+
{{#set: molecular weight=149.149    }}
+
{{#set: produced by=INDOLE-23-DIOXYGENASE-RXN}}
+

Revision as of 13:11, 21 March 2018

Pathway LEU-DEG2-PWY

  • taxonomic range:
  • common name:
    • L-leucine degradation I
  • Synonym(s):

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links