Difference between revisions of "PWY-6707"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-18_000790 == * left end position: ** 764695 * transcription direction: ** POSITIVE * right end position: ** 768844 * centisome position: ** 15.521...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_000790 == |
− | * | + | * left end position: |
− | ** | + | ** 764695 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 768844 |
− | * | + | * centisome position: |
− | ** | + | ** 15.521894 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0020_0105 |
− | ** | + | ** Esi0020_0105 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GLYOXIII-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=764695}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=768844}} | |
− | + | {{#set: centisome position=15.521894 }} | |
− | + | {{#set: common name=Esi_0020_0105|Esi0020_0105}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:11, 21 March 2018
Gene Ec-18_000790
- left end position:
- 764695
- transcription direction:
- POSITIVE
- right end position:
- 768844
- centisome position:
- 15.521894
- Synonym(s):
- Esi_0020_0105
- Esi0020_0105
Reactions associated
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome