Difference between revisions of "RXN-5861"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common name: ** an apo-[VibB aryl-carrier protein] * Synonym(s): == Reaction(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == |
| + | * smiles: | ||
| + | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A12 |
| + | * molecular weight: | ||
| + | ** 330.423 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** C20-GAs | ||
| + | ** open lactone gibberrellin skeleton | ||
| + | ** C20 skeleton | ||
| + | ** C20-GA skeleton | ||
| + | ** C20-gibberellin skeleton | ||
| + | ** GA12 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1F-162]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN1F-161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104170014 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857] | ||
| + | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
| + | {{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}} | ||
| + | {{#set: common name=gibberellin A12}} | ||
| + | {{#set: molecular weight=330.423 }} | ||
| + | {{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}} | ||
| + | {{#set: consumed by=RXN1F-162}} | ||
| + | {{#set: produced by=RXN1F-161}} | ||
Revision as of 13:11, 21 March 2018
Contents
Metabolite CPD1F-95
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
- common name:
- gibberellin A12
- molecular weight:
- 330.423
- Synonym(s):
- C20-GAs
- open lactone gibberrellin skeleton
- C20 skeleton
- C20-GA skeleton
- C20-gibberellin skeleton
- GA12
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.
