Difference between revisions of "L-CYSTEATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...") |
(Created page with "Category:Gene == Gene Ec-06_000280 == * left end position: ** 205108 * transcription direction: ** NEGATIVE * right end position: ** 205986 * centisome position: ** 2.3420...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_000280 == |
− | * | + | * left end position: |
− | ** | + | ** 205108 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 205986 |
− | * | + | * centisome position: |
− | ** | + | ** 2.342015 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0085_0088 |
− | ** | + | ** Esi0085_0088 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=205108}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=205986}} | |
− | + | {{#set: centisome position=2.342015 }} | |
− | + | {{#set: common name=Esi_0085_0088|Esi0085_0088}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:11, 21 March 2018
Gene Ec-06_000280
- left end position:
- 205108
- transcription direction:
- NEGATIVE
- right end position:
- 205986
- centisome position:
- 2.342015
- Synonym(s):
- Esi_0085_0088
- Esi0085_0088
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome