Difference between revisions of "Ec-04 001470"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
 
* common name:
 
* common name:
** glycine biosynthesis III
+
** 1,2-dihydro-β-NADP
 +
* molecular weight:
 +
** 741.394   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
 +
** 2DHNADP
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-16765]]
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Ec-21_003730]]
+
*** [[Ec-14_006580]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
{{#set: taxonomic range=TAX-2157}}
+
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
{{#set: taxonomic range=TAX-2759}}
+
{{#set: common name=1,2-dihydro-β-NADP}}
{{#set: common name=glycine biosynthesis III}}
+
{{#set: molecular weight=741.394    }}
{{#set: reaction found=1}}
+
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
{{#set: total reaction=1}}
+
{{#set: produced by=RXN-16765}}
{{#set: completion rate=100.0}}
+

Revision as of 14:12, 21 March 2018

Metabolite CPD-18085

  • smiles:
    • C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
  • inchi key:
    • InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
  • common name:
    • 1,2-dihydro-β-NADP
  • molecular weight:
    • 741.394
  • Synonym(s):
    • 2-dihydro-nicotinamide adenine dinucleotide phosphate
    • 2DHNADP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)" cannot be used as a page name in this wiki.