Difference between revisions of "Ec-18 002500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
 
* common name:
 
* common name:
−
** glycolysis III (from glucose)
+
** delphinidin 3,5-di-O-β-D-glucoside
 +
* molecular weight:
 +
** 626.524   
 
* Synonym(s):
 
* Synonym(s):
−
** anaerobic glycolysis
+
** delphinidin-3,5-diglucoside
−
** Embden-Meyerhof-Parnas pathway
+
−
** EMP pathway
+
−
** glycolysis III (glucokinase)
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''10''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[2PGADEHYDRAT-RXN]]
+
* [[RXN-8228]]
−
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-27_004000]]
+
−
*** [[Ec-26_004120]]
+
−
*** [[Ec-14_005400]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[6PFRUCTPHOS-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-12_002540]]
+
−
*** [[Ec-22_000070]]
+
−
*** [[Ec-14_003880]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[F16ALDOLASE-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-10_000880]]
+
−
*** [[Ec-10_004980]]
+
−
*** [[Ec-14_001680]]
+
−
*** [[Ec-01_008040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[GAPOXNPHOSPHN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-25_003550]]
+
−
*** [[Ec-19_001850]]
+
−
*** [[Ec-19_003020]]
+
−
*** [[Ec-08_000500]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[GLUCOKIN-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_005030]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PEPDEPHOS-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-26_004170]]
+
−
*** [[Ec-12_000950]]
+
−
*** [[Ec-06_006860]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PGLUCISOM-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-24_002470]]
+
−
*** [[Ec-13_003530]]
+
−
*** [[Ec-13_003810]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PHOSGLYPHOS-RXN]]
+
−
** 6 associated gene(s):
+
−
*** [[Ec-12_004530]]
+
−
*** [[Ec-01_001350]]
+
−
*** [[Ec-08_002400]]
+
−
*** [[Ec-12_004550]]
+
−
*** [[Ec-21_005710]]
+
−
*** [[Ec-21_004220]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-15513]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-08_000500]]
+
−
*** [[Ec-23_004160]]
+
−
*** [[Ec-03_002790]]
+
−
*** [[Ec-24_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
−
{{#set: common name=glycolysis III (from glucose)}}
+
* CHEBI:
−
{{#set: common name=anaerobic glycolysis|Embden-Meyerhof-Parnas pathway|EMP pathway|glycolysis III (glucokinase)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
−
{{#set: reaction found=10}}
+
* LIGAND-CPD:
−
{{#set: total reaction=10}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
−
{{#set: completion rate=100.0}}
+
* HMDB : HMDB30693
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
 +
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
 +
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
 +
{{#set: molecular weight=626.524    }}
 +
{{#set: common name=delphinidin-3,5-diglucoside}}
 +
{{#set: produced by=RXN-8228}}

Revision as of 13:12, 21 March 2018

Metabolite CPD-7139

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
  • inchi key:
    • InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
  • common name:
    • delphinidin 3,5-di-O-β-D-glucoside
  • molecular weight:
    • 626.524
  • Synonym(s):
    • delphinidin-3,5-diglucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_002500&oldid=16485"