Difference between revisions of "Charged-PHE-tRNAs"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15619 CPD-15619] == * smiles: ** CC(C(O)C(O)C([CH]=O)O)O * inchi key: ** InChIKey=PNNNRSAQS...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15619 CPD-15619] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C(O)C(O)C([CH]=O)O)O |
| + | * inchi key: | ||
| + | ** InChIKey=PNNNRSAQSRJVSB-KCDKBNATSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-L-fucose |
| + | * molecular weight: | ||
| + | ** 164.158 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14813]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3034656 3034656] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48204 48204] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C(O)C(O)C([CH]=O)O)O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PNNNRSAQSRJVSB-KCDKBNATSA-N}} |
| − | {{#set: | + | {{#set: common name=aldehydo-L-fucose}} |
| − | + | {{#set: molecular weight=164.158 }} | |
| + | {{#set: reversible reaction associated=RXN-14813}} | ||
Revision as of 13:12, 21 March 2018
Contents
Metabolite CPD-15619
- smiles:
- CC(C(O)C(O)C([CH]=O)O)O
- inchi key:
- InChIKey=PNNNRSAQSRJVSB-KCDKBNATSA-N
- common name:
- aldehydo-L-fucose
- molecular weight:
- 164.158
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(O)C(O)C([CH]=O)O)O" cannot be used as a page name in this wiki.
