Difference between revisions of "Ec-08 000930"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Reduced Cytochromes-C-Reduced] == * common name: ** a reduced c-type cytochrome *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Reduced Cytochromes-C-Reduced] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] ==
 +
* smiles:
 +
** C(C1(OC(C(C(C=1)O)O)O))([O-])=O
 +
* inchi key:
 +
** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
 
* common name:
 
* common name:
−
** a reduced c-type cytochrome
+
** 4-deoxy-L-threo-hex-4-enopyranuronate
 +
* molecular weight:
 +
** 175.118   
 
* Synonym(s):
 
* Synonym(s):
−
** a reduced cytochrome c protein
+
** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
−
** a ferrocytochrome c
+
** 4-deoxy-L-threo-5-hexosulose-uronic acid
−
** a reduced cytochrome c
+
** 4-deoxy-L-threo-5-hexosulose-uronate
−
** a ferro c-type cytochrome c
+
** 4-deoxy-L-threo-hex-4-enopyranuronate
 +
** 4-deoxy-β-L-threo-hex-4-enopyranuronose
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15830]]
 
−
* [[CYTOCHROME-C-OXIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14107]]
+
* [[RXN-12178]]
−
* [[RXN-15815]]
+
* [[RXN-12270]]
−
* [[RXN-12876]]
+
−
* [[RXN-15816]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[1.10.2.2-RXN]]
+
* [[RXN-16475]]
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a reduced c-type cytochrome}}
+
* PUBCHEM:
−
{{#set: common name=a reduced cytochrome c protein|a ferrocytochrome c|a reduced cytochrome c|a ferro c-type cytochrome c}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971]
−
{{#set: consumed by=RXN-15830|CYTOCHROME-C-OXIDASE-RXN}}
+
* CHEBI:
−
{{#set: produced by=RXN-14107|RXN-15815|RXN-12876|RXN-15816}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482]
−
{{#set: reversible reaction associated=1.10.2.2-RXN}}
+
{{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}}
 +
{{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}}
 +
{{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}}
 +
{{#set: molecular weight=175.118    }}
 +
{{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}}
 +
{{#set: produced by=RXN-12178|RXN-12270}}
 +
{{#set: reversible reaction associated=RXN-16475}}

Revision as of 13:12, 21 March 2018

Metabolite CPD-13122

  • smiles:
    • C(C1(OC(C(C(C=1)O)O)O))([O-])=O
  • inchi key:
    • InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
  • common name:
    • 4-deoxy-L-threo-hex-4-enopyranuronate
  • molecular weight:
    • 175.118
  • Synonym(s):
    • (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
    • 4-deoxy-L-threo-5-hexosulose-uronic acid
    • 4-deoxy-L-threo-5-hexosulose-uronate
    • 4-deoxy-L-threo-hex-4-enopyranuronate
    • 4-deoxy-β-L-threo-hex-4-enopyranuronose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C=1)O)O)O))([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_000930&oldid=16544"