Difference between revisions of "CPD-15360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
(Created page with "Category:Gene == Gene Ec-00_006960 == * left end position: ** 11018266 * transcription direction: ** POSITIVE * right end position: ** 11030755 * centisome position: ** 58...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_006960 == |
− | * | + | * left end position: |
− | ** | + | ** 11018266 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11030755 |
− | * | + | * centisome position: |
− | ** | + | ** 58.154835 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0526_0006 |
+ | ** Esi0526_0006 | ||
+ | ** Amt1;4 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-9615]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=11018266}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11030755}} | |
− | + | {{#set: centisome position=58.154835 }} | |
− | + | {{#set: common name=Esi_0526_0006|Esi0526_0006|Amt1;4}} | |
− | + | {{#set: reaction associated=RXN-9615}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:12, 21 March 2018
Gene Ec-00_006960
- left end position:
- 11018266
- transcription direction:
- POSITIVE
- right end position:
- 11030755
- centisome position:
- 58.154835
- Synonym(s):
- Esi_0526_0006
- Esi0526_0006
- Amt1;4
Reactions associated
- Reaction: RXN-9615
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome