Difference between revisions of "PWY0-1507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15360 CPD-15360] == * smiles: ** CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15360 CPD-15360] ==
 
* smiles:
 
* smiles:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))
* inchi key:
+
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
 
* common name:
 
* common name:
** gibberellin A15 (open lactone form)
+
** 2-thio-N6-dimethylallyladenosine37 in tRNA
* molecular weight:
+
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A15
+
** tRNA-(2-thio-N6-dimethylallyladenosine37)
** GA15
+
** a tRNA containing 2-thio-N6-dimethylallyladenosine37
** GA15 (open lactone form)
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-163]]
+
* [[RXN-14481]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-162]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14480]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170017
 
* PUBCHEM:
 
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
 
 
* CHEBI:
 
* CHEBI:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74416 74416]
* LIGAND-CPD:
+
{{#set: smiles=CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))}}
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
{{#set: common name=2-thio-N6-dimethylallyladenosine37 in tRNA}}
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: common name=tRNA-(2-thio-N6-dimethylallyladenosine37)|a tRNA containing 2-thio-N6-dimethylallyladenosine37}}
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
{{#set: consumed by=RXN-14481}}
{{#set: common name=gibberellin A15 (open lactone form)}}
+
{{#set: reversible reaction associated=RXN-14480}}
{{#set: molecular weight=346.422    }}
+
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
{{#set: consumed by=RXN1F-163}}
+
{{#set: produced by=RXN1F-162}}
+

Revision as of 14:12, 21 March 2018

Metabolite CPD-15360

  • smiles:
    • CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))
  • common name:
    • 2-thio-N6-dimethylallyladenosine37 in tRNA
  • Synonym(s):
    • tRNA-(2-thio-N6-dimethylallyladenosine37)
    • a tRNA containing 2-thio-N6-dimethylallyladenosine37

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCNC2(C1(N=CN(C=1N=C(S)N=2)C3(OC(COP(O[a tRNA])(=O)[O-])C(OP([O-])(=O)O[a tRNA])C(O)3)))" cannot be used as a page name in this wiki.