Difference between revisions of "Branched-chain-2-keto-acid-deH-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14283 RXN-14283] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucosidase 2 subunit beta...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14283 RXN-14283] ==
−
* smiles:
+
* direction:
−
** C(C([O-])=O)NC(C(CS)[N+])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
+
 
* common name:
 
* common name:
−
** L-cysteinyl-glycine
+
** Glucosidase 2 subunit beta
−
* molecular weight:
+
** Glucosidase II beta subunit, N-terminal
−
** 178.206   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.20 EC-3.2.1.20]
 
* Synonym(s):
 
* Synonym(s):
−
** Cys-Gly
 
−
** cysteinylglycine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-6622]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD0-1133]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[MALTOHEXAOSE]][c]
−
* [[RXN-6601]]
+
* With common name(s):
−
* [[RXN-9157]]
+
** 1 H2O[c] '''+''' 1 maltoheptaose[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 maltohexaose[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_006760]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-23_001860]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 1445980
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Glucosidase 2 subunit beta}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621]
+
{{#set: common name=Glucosidase II beta subunit, N-terminal}}
−
* HMDB : HMDB00078
+
{{#set: ec number=EC-3.2.1.20}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-01_006760|Ec-23_001860}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC4047
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}}
+
−
{{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}}
+
−
{{#set: common name=L-cysteinyl-glycine}}
+
−
{{#set: molecular weight=178.206    }}
+
−
{{#set: common name=Cys-Gly|cysteinylglycine}}
+
−
{{#set: consumed by=RXN-6622}}
+
−
{{#set: produced by=RXN-6601|RXN-9157}}
+

Revision as of 13:12, 21 March 2018

Reaction RXN-14283

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucosidase 2 subunit beta
    • Glucosidase II beta subunit, N-terminal
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Branched-chain-2-keto-acid-deH-P&oldid=16617"