Difference between revisions of "SPHINGOLIPID-SYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-09_003180 == * left end position: ** 3609603 * transcription direction: ** NEGATIVE * right end position: ** 3634328 * centisome position: ** 64.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-09_003180 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
* left end position:
+
* smiles:
** 3609603
+
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
* right end position:
+
* common name:
** 3634328
+
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
* centisome position:
+
* molecular weight:
** 64.30607    
+
** 285.193    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0021_0133
+
** C1-(3-Indolyl)-glycerol 3-phosphate
** Esi0021_0133
+
** indole-3-glycerol-P
 +
** 1-(indol-3-yl)glycerol-3-P
 +
** 1-(indol-3-yl)glycerol-3-phosphate
 +
** indoleglycerol phosphate
 +
** indole-3-glycerol-phosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.11.2-RXN]]
+
* [[TRYPSYN-RXN]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[IGPSYN-RXN]]
* [[RXN-13677]]
+
== Reaction(s) of unknown directionality ==
** esiliculosus_genome
+
* [[RXN0-2381]]
***ec-number
+
* [[RXN-6642]]
+
** esiliculosus_genome
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7112]]
+
* [[PWY-6842]]
+
* [[PWY-4061]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3609603}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
{{#set: right end position=3634328}}
+
* CHEBI:
{{#set: centisome position=64.30607   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
{{#set: common name=Esi_0021_0133|Esi0021_0133}}
+
* BIGG : 41982
{{#set: reaction associated=3.4.11.2-RXN|RXN-13677|RXN-6642}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
 +
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
 +
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
 +
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
 +
{{#set: molecular weight=285.193   }}
 +
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
 +
{{#set: consumed by=TRYPSYN-RXN}}
 +
{{#set: produced by=IGPSYN-RXN}}
 +
{{#set: reversible reaction associated=RXN0-2381}}

Revision as of 14:12, 21 March 2018

Metabolite INDOLE-3-GLYCEROL-P

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
  • inchi key:
    • InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
  • common name:
    • (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
  • molecular weight:
    • 285.193
  • Synonym(s):
    • C1-(3-Indolyl)-glycerol 3-phosphate
    • indole-3-glycerol-P
    • 1-(indol-3-yl)glycerol-3-P
    • 1-(indol-3-yl)glycerol-3-phosphate
    • indoleglycerol phosphate
    • indole-3-glycerol-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.