Difference between revisions of "Ec-26 005200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERKIN-RXN HOMOSERKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** homoserine kinase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERKIN-RXN HOMOSERKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
 +
* inchi key:
 +
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
 
* common name:
 
* common name:
−
** homoserine kinase
+
** shikimate 3-phosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.39 EC-2.7.1.39]
+
** 251.109   
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimate 5-phosphate
 +
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[HOMO-SER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[O-PHOSPHO-L-HOMOSERINE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[2.5.1.19-RXN]]
−
** 1 ATP[c] '''+''' 1 L-homoserine[c] '''=>''' 1 ADP[c] '''+''' 1 O-phospho-L-homoserine[c] '''+''' 1 H+[c]
+
* [[SHIKIMATE-KINASE-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-11_006270]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
* [[HOMOSER-THRESYN-PWY]], L-threonine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-THRESYN-PWY HOMOSER-THRESYN-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13985 13985]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01771 R01771]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
−
* UNIPROT:
+
* BIGG : 41343
−
** [http://www.uniprot.org/uniprot/P27722 P27722]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9PIZ3 Q9PIZ3]
+
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
−
** [http://www.uniprot.org/uniprot/P04948 P04948]
+
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
−
** [http://www.uniprot.org/uniprot/Q9UZV7 Q9UZV7]
+
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
−
** [http://www.uniprot.org/uniprot/Q9CGD7 Q9CGD7]
+
{{#set: common name=shikimate 3-phosphate}}
−
** [http://www.uniprot.org/uniprot/P44504 P44504]
+
{{#set: molecular weight=251.109    }}
−
** [http://www.uniprot.org/uniprot/P52991 P52991]
+
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
−
** [http://www.uniprot.org/uniprot/P00547 P00547]
+
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}
−
** [http://www.uniprot.org/uniprot/P07128 P07128]
+
−
** [http://www.uniprot.org/uniprot/P17423 P17423]
+
−
** [http://www.uniprot.org/uniprot/P73646 P73646]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=homoserine kinase}}
+
−
{{#set: ec number=EC-2.7.1.39}}
+
−
{{#set: gene associated=Ec-11_006270}}
+
−
{{#set: in pathway=PWY-702|HOMOSER-THRESYN-PWY}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Revision as of 13:13, 21 March 2018

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • common name:
    • shikimate 3-phosphate
  • molecular weight:
    • 251.109
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_005200&oldid=16682"