Difference between revisions of "RXN-14903"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5407 PWY-5407] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5407 PWY-5407] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 9-lipoxygenase and 9-allene oxide synthase pathway |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 9-LOX and 9-AOS pathway |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-8497]] |
| − | * [[RXN- | + | ** 4 associated gene(s): |
| + | *** [[Ec-03_000010]] | ||
| + | *** [[Ec-20_003630]] | ||
| + | *** [[Ec-20_003620]] | ||
| + | *** [[Ec-03_000020]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8495 RXN-8495] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8499 RXN-8499] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8500 RXN-8500] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8501 RXN-8501] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=9-lipoxygenase and 9-allene oxide synthase pathway}} | |
| − | + | {{#set: common name=9-LOX and 9-AOS pathway}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:13, 21 March 2018
Pathway PWY-5407
- taxonomic range:
- common name:
- 9-lipoxygenase and 9-allene oxide synthase pathway
- Synonym(s):
- 9-LOX and 9-AOS pathway
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-8497
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
