Difference between revisions of "PWY-5523"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-04_003190 == * left end position: ** 3251186 * transcription direction: ** NEGATIVE * right end position: ** 3257815 * centisome position: ** 49.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_003190 == |
− | * | + | * left end position: |
− | ** | + | ** 3251186 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3257815 |
− | * | + | * centisome position: |
− | ** | + | ** 49.927216 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0080_0114 |
+ | ** Esi0080_0114 | ||
+ | ** PK | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3251186}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3257815}} | |
− | + | {{#set: centisome position=49.927216 }} | |
− | + | {{#set: common name=Esi_0080_0114|Esi0080_0114|PK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:13, 21 March 2018
Gene Ec-04_003190
- left end position:
- 3251186
- transcription direction:
- NEGATIVE
- right end position:
- 3257815
- centisome position:
- 49.927216
- Synonym(s):
- Esi_0080_0114
- Esi0080_0114
- PK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome