Difference between revisions of "1.6.5.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J
+
 
* common name:
 
* common name:
−
** (E)-cinnamoyl-CoA
+
** D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis
−
* molecular weight:
+
−
** 893.648   
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans-cinnamoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-7645]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.133-RXN]]
−
* [[RXN-2001]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-05_003010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[2.7.1.140-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10945 RXN-10945]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7162 RXN-7162]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229143 44229143]
+
{{#set: common name=D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57252 57252]
+
{{#set: total reaction=4}}
−
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16256 C16256]
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J}}
+
−
{{#set: common name=(E)-cinnamoyl-CoA}}
+
−
{{#set: molecular weight=893.648    }}
+
−
{{#set: common name=trans-cinnamoyl-CoA}}
+
−
{{#set: consumed by=RXN-7645}}
+
−
{{#set: produced by=RXN-2001}}
+

Revision as of 13:13, 21 March 2018

Pathway PWY-6366

  • taxonomic range:
  • common name:
    • D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=1.6.5.4-RXN&oldid=16719"