Difference between revisions of "DTMPKI-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC...")
(Created page with "Category:Gene == Gene Ec-04_002960 == * Synonym(s): ** Esi_0201_0024 ** Esi0201_0024 ** ALG11 == Reactions associated == * Reaction: RXN-15117 ** Source: orthology-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+
== Gene Ec-04_002960 ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I
+
−
* common name:
+
−
** (E)-2-benzylidenesuccinyl-CoA
+
−
* molecular weight:
+
−
** 950.677   
+
 
* Synonym(s):
 
* Synonym(s):
−
** E-phenylitaconyl-CoA
+
** Esi_0201_0024
 +
** Esi0201_0024
 +
** ALG11
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-902]]
+
* Reaction: [[RXN-15117]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0201_0024|Esi0201_0024|ALG11}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986140 50986140]
+
{{#set: reaction associated=RXN-15117}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27639 27639]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C09818 C09818]
+
−
* HMDB : HMDB12223
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I}}
+
−
{{#set: common name=(E)-2-benzylidenesuccinyl-CoA}}
+
−
{{#set: molecular weight=950.677    }}
+
−
{{#set: common name=E-phenylitaconyl-CoA}}
+
−
{{#set: consumed by=RXN-902}}
+

Revision as of 13:14, 21 March 2018

Gene Ec-04_002960

  • Synonym(s):
    • Esi_0201_0024
    • Esi0201_0024
    • ALG11

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DTMPKI-RXN&oldid=16818"