Difference between revisions of "Ec-04 003810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1303 PWY0-1303] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1303 PWY0-1303] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** aminopropylcadaverine biosynthesis
−
* molecular weight:
+
−
** 444.74   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-12]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN0-5217]]
−
* [[RXN66-11]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-17_001590]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LYSDECARBOX-RXN LYSDECARBOX-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1303 PWY0-1303]
−
* HMDB : HMDB12160
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: common name=aminopropylcadaverine biosynthesis}}
−
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: reaction found=1}}
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: total reaction=2}}
−
{{#set: molecular weight=444.74    }}
+
{{#set: completion rate=50.0}}
−
{{#set: consumed by=RXN66-12}}
+
−
{{#set: produced by=RXN66-11}}
+

Revision as of 13:14, 21 March 2018

Pathway PWY0-1303

  • taxonomic range:
  • common name:
    • aminopropylcadaverine biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_003810&oldid=16879"