Difference between revisions of "PWY-5366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8349_PLANTCYC RXN-8349_PLANTCYC] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8349_PLANTCYC RXN-8349_PLANTCYC] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
+
−
* common name:
+
−
** 9(S)-HPOTE
+
−
* molecular weight:
+
−
** 309.425   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
 
−
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8497]]
+
** 1.0 [[CPD-12653]][c] '''+''' 2.0 [[NADPH]][c] '''+''' 3.0 [[PROTON]][c] '''+''' 1.0 [[MALONYL-ACP]][c] '''<=>''' 1.0 [[CPD-8121]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 2.0 [[NADP]][c] '''+''' 1.0 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 stearidonate[c] '''+''' 2.0 NADPH[c] '''+''' 3.0 H+[c] '''+''' 1.0 a malonyl-[acp][c] '''<=>''' 1.0 icosatetraenoate[c] '''+''' 1.0 H2O[c] '''+''' 1.0 CO2[c] '''+''' 2.0 NADP+[c] '''+''' 1.0 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-1_cycrxns_to_add]]
 +
*** Comment: [[reaction from plantcyc20.5]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=manual}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962]
+
{{#set: reconstruction source=manual-1_cycrxns_to_add}}
−
* LIGAND-CPD:
+
{{#set: reconstruction comment=reaction from plantcyc20.5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321]
+
−
{{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}}
+
−
{{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}}
+
−
{{#set: common name=9(S)-HPOTE}}
+
−
{{#set: molecular weight=309.425    }}
+
−
{{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}}
+
−
{{#set: produced by=RXN-8497}}
+

Revision as of 13:14, 21 March 2018

Reaction RXN-8349_PLANTCYC

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 stearidonate[c] + 2.0 NADPH[c] + 3.0 H+[c] + 1.0 a malonyl-[acp][c] <=> 1.0 icosatetraenoate[c] + 1.0 H2O[c] + 1.0 CO2[c] + 2.0 NADP+[c] + 1.0 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5366&oldid=16930"