Difference between revisions of "Ec-24 002370"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MN+2 MN+2] == * smiles: ** [Mn++] * inchi key: ** InChIKey=WAEMQWOKJMHJLA-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * smiles: ** C(CC([N+])C(=O)[O-])ON * inchi key: ** InChIKey=FQPGMQAB...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == |
* smiles: | * smiles: | ||
− | ** [ | + | ** C(CC([N+])C(=O)[O-])ON |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N |
* common name: | * common name: | ||
− | ** | + | ** L-canaline |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 134.135 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-a-amino-g-(aminooxy)-n-butyric acid |
− | ** | + | ** L-2-amino-4-(aminooxy)butyric acid |
− | ** | + | ** L-2-amino-4-(aminooxy)butyrate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-34]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 496-93-5 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246035 25246035] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08270 C08270] |
− | * | + | * HMDB : HMDB12251 |
− | + | {{#set: smiles=C(CC([N+])C(=O)[O-])ON}} | |
− | + | {{#set: inchi key=InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N}} | |
− | + | {{#set: common name=L-canaline}} | |
− | + | {{#set: molecular weight=134.135 }} | |
− | {{#set: smiles=[ | + | {{#set: common name=L-a-amino-g-(aminooxy)-n-butyric acid|L-2-amino-4-(aminooxy)butyric acid|L-2-amino-4-(aminooxy)butyrate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-9}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-34}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + | |
− | + |
Revision as of 14:15, 21 March 2018
Contents
Metabolite L-CANALINE
- smiles:
- C(CC([N+])C(=O)[O-])ON
- inchi key:
- InChIKey=FQPGMQABJNQLLF-VKHMYHEASA-N
- common name:
- L-canaline
- molecular weight:
- 134.135
- Synonym(s):
- L-a-amino-g-(aminooxy)-n-butyric acid
- L-2-amino-4-(aminooxy)butyric acid
- L-2-amino-4-(aminooxy)butyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ON" cannot be used as a page name in this wiki.