Difference between revisions of "PWY-6167"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...")
(Created page with "Category:Gene == Gene Ec-10_003310 == * left end position: ** 3365640 * transcription direction: ** NEGATIVE * right end position: ** 3374993 * centisome position: ** 51.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
+
== Gene Ec-10_003310 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])CC1(=CC=CC=C(O)1)
+
** 3365640
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2-hydroxyphenylacetate
+
** 3374993
−
* molecular weight:
+
* centisome position:
−
** 151.141    
+
** 51.77123    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxyphenylacetic acid
+
** Esi_0117_0019
−
** benzeneacetic acid, 2-hydroxy-
+
** Esi0117_0019
−
** 2-hydroxybenzeneacetic acid
+
** GPD
−
** acetic acid, (o-hydroxyphenyl)-
+
−
** o-hydroxy phenylacetic acid
+
−
** o-hydroxyphenylacetate
+
−
** o-hydroxyphenylacetic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15740]]
−
* [[RXN-10815]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN-15745]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-5260]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6118]]
 +
* [[PWY-4261]]
 +
* [[PWY0-1561]]
 +
* [[PWY-6952]]
 +
* [[PWY0-1582]]
 +
* [[PWY0-1581]]
 +
* [[PWY0-1584]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3365640}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3374993}}
−
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
+
{{#set: centisome position=51.77123    }}
−
* CHEBI:
+
{{#set: common name=Esi_0117_0019|Esi0117_0019|GPD}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
+
{{#set: reaction associated=RXN-15740|RXN-15745|RXN0-5260}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6118|PWY-4261|PWY0-1561|PWY-6952|PWY0-1582|PWY0-1581|PWY0-1584}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
+
−
* HMDB : HMDB00669
+
−
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
+
−
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-hydroxyphenylacetate}}
+
−
{{#set: molecular weight=151.141    }}
+
−
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
+
−
{{#set: produced by=RXN-10815}}
+

Revision as of 13:15, 21 March 2018

Gene Ec-10_003310

  • left end position:
    • 3365640
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3374993
  • centisome position:
    • 51.77123
  • Synonym(s):
    • Esi_0117_0019
    • Esi0117_0019
    • GPD

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6167&oldid=17083"