Difference between revisions of "RXN-15513"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] ==
* smiles:
+
* taxonomic range:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** chlorophyllide b
+
** 8-amino-7-oxononanoate biosynthesis II
* molecular weight:
+
** 626.95   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-keto-8-aminopelargonate biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-7677]]
+
* [[RXN-11484]]
* [[RXN-13398]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-04_002200]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13834 RXN-13834]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis II}}
* CHEBI:
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis II}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: completion rate=50.0}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyllide b}}
+
{{#set: molecular weight=626.95    }}
+
{{#set: produced by=RXN-7677|RXN-13398}}
+

Revision as of 13:16, 21 March 2018

Pathway PWY-7147

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis II
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis II

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links