Difference between revisions of "GALACTONOLACTONASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUDEG-II-PWY GLUDEG-II-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUDEG-II-PWY GLUDEG-II-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
+
** C(=O)([O-])CC1(=CC=CC=C(O)1)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
* inchi key:
 +
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** L-glutamate degradation VII (to butanoate)
+
** 2-hydroxyphenylacetate
 +
* molecular weight:
 +
** 151.141   
 
* Synonym(s):
 
* Synonym(s):
−
** L-glutamate fermentation
+
** 2-hydroxyphenylacetic acid
−
** mesaconate pathway
+
** benzeneacetic acid, 2-hydroxy-
−
** L-glutamate degradation VII (to butyrate)
+
** 2-hydroxybenzeneacetic acid
 +
** acetic acid, (o-hydroxyphenyl)-
 +
** o-hydroxy phenylacetic acid
 +
** o-hydroxyphenylacetate
 +
** o-hydroxyphenylacetic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[CENTFERM-PWY]]
+
* [[RXN-10815]]
−
** 0 associated gene:
+
== Reaction(s) of unknown directionality ==
−
* [[HYDROG-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-22_001020]]
+
−
*** [[Ec-24_003110]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PYRUFLAVREDUCT-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-23_002710]]
+
−
*** [[Ec-15_004230]]
+
−
*** [[Ec-18_003420]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5087 PWY-5087]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5087 PWY-5087]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-1239}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-1224}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
−
{{#set: common name=L-glutamate degradation VII (to butanoate)}}
+
* CHEMSPIDER:
−
{{#set: common name=L-glutamate fermentation|mesaconate pathway|L-glutamate degradation VII (to butyrate)}}
+
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
−
{{#set: reaction found=3}}
+
* CHEBI:
−
{{#set: total reaction=6}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
−
{{#set: completion rate=50.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
 +
* HMDB : HMDB00669
 +
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
 +
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
 +
{{#set: common name=2-hydroxyphenylacetate}}
 +
{{#set: molecular weight=151.141    }}
 +
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
 +
{{#set: produced by=RXN-10815}}

Revision as of 13:16, 21 March 2018

Metabolite CPD-11495

  • smiles:
    • C(=O)([O-])CC1(=CC=CC=C(O)1)
  • inchi key:
    • InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
  • common name:
    • 2-hydroxyphenylacetate
  • molecular weight:
    • 151.141
  • Synonym(s):
    • 2-hydroxyphenylacetic acid
    • benzeneacetic acid, 2-hydroxy-
    • 2-hydroxybenzeneacetic acid
    • acetic acid, (o-hydroxyphenyl)-
    • o-hydroxy phenylacetic acid
    • o-hydroxyphenylacetate
    • o-hydroxyphenylacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(=CC=CC=C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GALACTONOLACTONASE-RXN&oldid=17133"