Difference between revisions of "GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CYS HOMO-CYS] == * smiles: ** C(C(CCS)[N+])(=O)[O-] * inchi key: ** InChIKey=FFFHZYDWPBMWH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12579 RXN-12579] == * direction: ** LEFT-TO-RIGHT * common name: ** triglyceride lipase ** EsV-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CYS HOMO-CYS] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12579 RXN-12579] ==
−
* smiles:
+
* direction:
−
** C(C(CCS)[N+])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FFFHZYDWPBMWHY-VKHMYHEASA-N
+
 
* common name:
 
* common name:
−
** L-homocysteine
+
** triglyceride lipase
−
* molecular weight:
+
** EsV-1-185
−
** 135.181   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.3 EC-3.1.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** homo-cys
 
−
** homocysteine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
+
* With identifiers:
−
* [[HOMOCYSMETB12-RXN]]
+
** 1 [[Dietary-retinyl-esters]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13524]][c] '''+''' 1 [[Long-Chain-Fatty-Acids]][c]
−
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
+
* With common name(s):
−
* [[MMUM-RXN]]
+
** 1 a dietary all-trans-retinyl ester[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 all-trans-retinol[c] '''+''' 1 a long-chain fatty acid[c]
−
== Reaction(s) known to produce the compound ==
+
 
−
* [[RXN-15131]]
+
== Genes associated with this reaction  ==
−
* [[CYSTATHIONINE-BETA-LYASE-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Ec-06_005070]]
−
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-9384]]
+
*** Assignment: EC-NUMBER
−
* [[HOMOCYSMET-RXN]]
+
* Gene: [[Ec-24_003610]]
−
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000190]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000020]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-16_003710]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-23_002330]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-23_002340]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_001660]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_003310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_004240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_001230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-16_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_004100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_004280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-23_002290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-27_003400]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6857]], retinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6027-13-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CAS : 454-28-4
+
{{#set: common name=triglyceride lipase}}
−
* BIGG : 45588
+
{{#set: common name=EsV-1-185}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.1.3}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971015 6971015]
+
{{#set: gene associated=Ec-06_005070|Ec-24_003610|Ec-15_000190|Ec-15_000020|Ec-16_003710|Ec-15_000240|Ec-23_002330|Ec-23_002340|Ec-15_000230|Ec-02_001660|Ec-06_003310|Ec-06_004240|Ec-15_000160|Ec-11_001230|Ec-16_000950|Ec-21_004100|Ec-11_004280|Ec-23_002290|Ec-27_003400}}
−
* HMDB : HMDB00742
+
{{#set: in pathway=PWY-6857}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00155 C00155]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58199 58199]
+
−
* METABOLIGHTS : MTBLC58199
+
−
{{#set: smiles=C(C(CCS)[N+])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FFFHZYDWPBMWHY-VKHMYHEASA-N}}
+
−
{{#set: common name=L-homocysteine}}
+
−
{{#set: molecular weight=135.181    }}
+
−
{{#set: common name=homo-cys|homocysteine}}
+
−
{{#set: consumed by=HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN|HOMOCYSMETB12-RXN|HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.|MMUM-RXN}}
+
−
{{#set: produced by=RXN-15131|CYSTATHIONINE-BETA-LYASE-RXN}}
+
−
{{#set: reversible reaction associated=ADENOSYLHOMOCYSTEINASE-RXN|RXN-9384|HOMOCYSMET-RXN|CYSTATHIONINE-BETA-SYNTHASE-RXN}}
+

Revision as of 13:16, 21 March 2018

Reaction RXN-12579

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • triglyceride lipase
    • EsV-1-185
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6857, retinol biosynthesis: PWY-6857
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN&oldid=17161"