Difference between revisions of "Ec-03 001180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-26_006250 == * Synonym(s): ** Esi_0059_0018 ** Esi0059_0018 == Reactions associated == * TCM3 ** pantograph-aragem * TCP26 ** p...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-26_006250 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
 +
* smiles:
 +
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
 +
* inchi key:
 +
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 +
* common name:
 +
** bisorganyltrisulfane
 +
* molecular weight:
 +
** 644.686   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0059_0018
+
** GS3G
** Esi0059_0018
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[TCM3]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[aragem]]
+
== Reaction(s) of unknown directionality ==
* [[TCP26]]
+
* [[RXN-10851]]
** [[pantograph]]-[[aragem]]
+
* [[TCX10]]
+
** [[pantograph]]-[[aragem]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0059_0018|Esi0059_0018}}
+
* PUBCHEM:
{{#set: reaction associated=TCM3|TCP26|TCX10}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
 +
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
 +
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
 +
{{#set: common name=bisorganyltrisulfane}}
 +
{{#set: molecular weight=644.686    }}
 +
{{#set: common name=GS3G}}
 +
{{#set: reversible reaction associated=RXN-10851}}

Revision as of 13:16, 21 March 2018

Metabolite CPD-11763

  • smiles:
    • C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
  • inchi key:
    • InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
  • common name:
    • bisorganyltrisulfane
  • molecular weight:
    • 644.686
  • Synonym(s):
    • GS3G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.