Difference between revisions of "RXN-2043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS2-peptidyl-carrier-protein LYS2-peptidyl-carrier-protein] == * common name: ** an apo-[LYS2...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS2-peptidyl-carrier-protein LYS2-peptidyl-carrier-protein] ==
* smiles:
+
** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
+
 
* common name:
 
* common name:
** densipoloyl-CoA
+
** an apo-[LYS2 peptidyl-carrier-protein]
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
  
Line 14: Line 8:
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-16150]]
+
* [[RXN-16759]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an apo-[LYS2 peptidyl-carrier-protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551]
+
{{#set: reversible reaction associated=RXN-16759}}
{{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}}
+
{{#set: common name=densipoloyl-CoA}}
+
{{#set: molecular weight=1041.936    }}
+
{{#set: reversible reaction associated=RXN-16150}}
+

Revision as of 13:16, 21 March 2018

Metabolite LYS2-peptidyl-carrier-protein

  • common name:
    • an apo-[LYS2 peptidyl-carrier-protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an apo-[LYS2 peptidyl-carrier-protein" cannot be used as a page name in this wiki.