Difference between revisions of "RXN-8342"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12056 RXN-12056] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12056 RXN-12056] ==
* smiles:
+
* direction:
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
** [http://enzyme.expasy.org/EC/6.5.1 EC-6.5.1]
* common name:
+
** 7-hydroxylauroyl-CoA
+
* molecular weight:
+
** 961.807   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxydodecanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12184]]
+
** 1 [[Pre-tRNA-3-prime-half-molecules]][c] '''+''' 1 [[Pre-tRNA-5-prime-half-molecules]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[2-phospho-ligated-tRNA]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[AMP]][c] '''+''' 2 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a 3' half-tRNA molecule with a hydroxyl on its 5' end[c] '''+''' 1 a 5' half-tRNA molecule with a 2',3' cyclic phosphate on its 3' end[c] '''+''' 1 H2O[c] '''+''' 2 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 a 2'-phospho-[ligated tRNA][c] '''+''' 1 ADP[c] '''+''' 1 AMP[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6689]], tRNA splicing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: ec number=EC-6.5.1}}
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-6689}}
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: molecular weight=961.807    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
{{#set: produced by=RXN-12184}}
+

Revision as of 20:36, 17 March 2018

Reaction RXN-12056

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6689, tRNA splicing: PWY-6689
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links