Difference between revisions of "INOPHOSPHOR-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == |
* smiles: | * smiles: | ||
− | ** C(=O)([O-]) | + | ** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M |
* common name: | * common name: | ||
− | ** | + | ** O-succinyl-L-homoserine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 218.186 |
* Synonym(s): | * Synonym(s): | ||
+ | ** O-succinyl-homoserine | ||
+ | ** succinyl-homoserine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
+ | * [[METBALT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HOMSUCTRAN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-9384]] |
== External links == | == External links == | ||
+ | * CAS : 1492-23-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661] |
+ | * BIGG : 36847 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118] |
− | + | {{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}} | |
− | {{#set: smiles=C(=O)([O-]) | + | {{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=O-succinyl-L-homoserine}} |
− | {{#set: common name= | + | {{#set: molecular weight=218.186 }} |
− | {{#set: molecular weight= | + | {{#set: common name=O-succinyl-homoserine|succinyl-homoserine}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=O-SUCCHOMOSERLYASE-RXN|METBALT-RXN}} |
− | {{#set: reversible reaction associated=RXN- | + | {{#set: produced by=HOMSUCTRAN-RXN}} |
+ | {{#set: reversible reaction associated=RXN-9384}} |
Revision as of 14:17, 21 March 2018
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- smiles:
- C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
- inchi key:
- InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
- common name:
- O-succinyl-L-homoserine
- molecular weight:
- 218.186
- Synonym(s):
- O-succinyl-homoserine
- succinyl-homoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O" cannot be used as a page name in this wiki.