Difference between revisions of "4-HYDROXYBENZALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-28_000990 == * left end position: ** 945381 * transcription direction: ** NEGATIVE * right end position: ** 957679 * centisome position: ** 24.950...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_000990 == |
− | * | + | * left end position: |
− | ** | + | ** 945381 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 957679 |
− | * | + | * centisome position: |
− | ** | + | ** 24.950542 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0098_0077 |
− | ** | + | ** Esi0098_0077 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ASNSYNA-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[ASNSYNB-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[GLUTAMIN-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[ASPARAGINE-BIOSYNTHESIS]] | ||
+ | * [[ASPARAGINESYN-PWY]] | ||
+ | * [[GLUTAMINDEG-PWY]] | ||
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=945381}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=957679}} | |
− | + | {{#set: centisome position=24.950542 }} | |
− | + | {{#set: common name=Esi_0098_0077|Esi0098_0077}} | |
− | + | {{#set: reaction associated=ASNSYNA-RXN|ASNSYNB-RXN|GLUTAMIN-RXN}} | |
− | + | {{#set: pathway associated=ASPARAGINE-BIOSYNTHESIS|ASPARAGINESYN-PWY|GLUTAMINDEG-PWY|CITRULBIO-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:17, 21 March 2018
Gene Ec-28_000990
- left end position:
- 945381
- transcription direction:
- NEGATIVE
- right end position:
- 957679
- centisome position:
- 24.950542
- Synonym(s):
- Esi_0098_0077
- Esi0098_0077
Reactions associated
- Reaction: ASNSYNA-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: ASNSYNB-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: GLUTAMIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome