Difference between revisions of "Ec-16 003710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.2.1 EC-2.4.2.1]
+
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
 +
* common name:
 +
** quinoxaline-2-carboxyl adenylate
 +
* molecular weight:
 +
** 502.359   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17155]]
−
** 1 [[INOSINE]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[RIBOSE-1P]][c] '''+''' 1 [[HYPOXANTHINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 inosine[c] '''+''' 1 phosphate[c] '''<=>''' 1 &alpha;-D-ribose-1-phosphate[c] '''+''' 1 hypoxanthine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY0-1296]], purine ribonucleosides degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1296 PWY0-1296]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6609]], adenine and adenosine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[SALVADEHYPOX-PWY]], adenosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27646 27646]
+
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
−
* LIGAND-RXN:
+
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01863 R01863]
+
{{#set: molecular weight=502.359    }}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: consumed by=RXN-17155}}
−
{{#set: ec number=EC-2.4.2.1}}
+
−
{{#set: in pathway=PWY0-1296|PWY-6609|SALVADEHYPOX-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 14:17, 21 March 2018

Metabolite CPD-18550

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
  • inchi key:
    • InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
  • common name:
    • quinoxaline-2-carboxyl adenylate
  • molecular weight:
    • 502.359
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_003710&oldid=17326"