Difference between revisions of "CONIFERYL-ALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(C(NC(CCC([N+])C([O-])=O)=O)C(=O)NCC([O-])=O)SC=O * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phenylpropanoids methylation (ice plant) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''10''' reactions in the full pathway |
− | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-28_003750]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-1104]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_004720]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.88-RXN 2.1.1.88-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13900 RXN-13900] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15534 RXN-15534] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15536 RXN-15536] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15537 RXN-15537] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8451 RXN-8451] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8452 RXN-8452] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=phenylpropanoids methylation (ice plant)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:17, 21 March 2018
Pathway PWY-7498
- taxonomic range:
- common name:
- phenylpropanoids methylation (ice plant)
- Synonym(s):
Reaction(s) found
2 reactions found over 10 reactions in the full pathway
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1104
- 1 associated gene(s):
- 1 reconstruction source(s) associated: