Difference between revisions of "PWY-5947"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == * common name: ** an oxidized [2Fe-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an oxidized [2Fe-2S] ferredoxin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-17472]] |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an oxidized [2Fe-2S] ferredoxin}} | |
| − | + | {{#set: produced by=2.8.1.6-RXN}} | |
| − | + | {{#set: reversible reaction associated=RXN-17472}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
| − | {{#set: reversible reaction associated= | + | |
Revision as of 13:18, 21 March 2018
Contents
Metabolite Oxidized-2Fe-2S-Ferredoxins
- common name:
- an oxidized [2Fe-2S] ferredoxin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an oxidized [2Fe-2S] ferredoxin" cannot be used as a page name in this wiki.
