Difference between revisions of "PWY-5939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8497 RXN-8497] == * direction: ** LEFT-TO-RIGHT * common name: ** linolenate 9S-lipoxygenase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8497 RXN-8497] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
 +
* inchi key:
 +
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
 
* common name:
 
* common name:
** linolenate 9S-lipoxygenase
+
** (S)-3-hydroxydecanoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.13.11 EC-1.13.11]
+
** 933.753   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12490]]
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[LINOLENIC_ACID]][c] '''=>''' 1 [[CPD-8678]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-13616]]
** 1 oxygen[c] '''+''' 1 α-linolenate[c] '''=>''' 1 9(S)-HPOTE[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-03_000010]]
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-20_003620]]
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-20_003630]]
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-03_000020]]
+
** [[pantograph]]-[[aragem]]
+
== Pathways  ==
+
* [[PWY-5406]], divinyl ether biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5406 PWY-5406]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-5407]], 9-lipoxygenase and 9-allene oxide synthase pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5407 PWY-5407]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-5408]], 9-lipoxygenase and 9-hydroperoxide lyase pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5408 PWY-5408]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6917]], vernolate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[aragem]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* LIGAND-CPD:
** [http://www.genome.jp/dbget-bin/www_bget?R07864 R07864]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: common name=linolenate 9S-lipoxygenase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
{{#set: ec number=EC-1.13.11}}
+
* BIGG : 45455
{{#set: gene associated=Ec-03_000010|Ec-20_003620|Ec-20_003630|Ec-03_000020}}
+
* PUBCHEM:
{{#set: in pathway=PWY-5406|PWY-5407|PWY-5408|PWY-6917}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB03938
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
{{#set: reconstruction source=aragem}}
+
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
 +
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
 +
{{#set: molecular weight=933.753    }}
 +
{{#set: consumed by=RXN-12490}}
 +
{{#set: produced by=RXN-13616}}

Revision as of 21:23, 17 March 2018

Metabolite CPD0-2244

  • smiles:
    • CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • inchi key:
    • InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
  • common name:
    • (S)-3-hydroxydecanoyl-CoA
  • molecular weight:
    • 933.753
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.