Difference between revisions of "PWY-6342"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == * smiles: ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J
+
 
* common name:
 
* common name:
−
** MoO2-molybdopterin cofactor
+
** vernolate biosynthesis III
−
* molecular weight:
+
−
** 519.251   
+
 
* Synonym(s):
 
* Synonym(s):
−
** MoCo (dioxyo)
+
** oat seed peroxygenase pathway
−
** molybdenum cofactor (dioxyo)
+
−
** MoO2(OH)Dtpp-mP
+
−
** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate
+
−
** MoO2-Mo-MPT
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN-8348]]
+
* [[LINOLEOYL-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-8497]]
 +
** 4 associated gene(s):
 +
*** [[Ec-03_000010]]
 +
*** [[Ec-20_003630]]
 +
*** [[Ec-20_003620]]
 +
*** [[Ec-03_000020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16219 RXN-16219]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283]
+
{{#set: common name=vernolate biosynthesis III}}
−
* CHEBI:
+
{{#set: common name=oat seed peroxygenase pathway}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302]
+
{{#set: reaction found=2}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}}
+
{{#set: total reaction=3}}
−
{{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}}
+
{{#set: completion rate=67.0}}
−
{{#set: common name=MoO2-molybdopterin cofactor}}
+
−
{{#set: molecular weight=519.251    }}
+
−
{{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}}
+
−
{{#set: produced by=RXN-8348}}
+

Revision as of 13:18, 21 March 2018

Pathway PWY-6917

  • taxonomic range:
  • common name:
    • vernolate biosynthesis III
  • Synonym(s):
    • oat seed peroxygenase pathway

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6342&oldid=17488"