Difference between revisions of "PWY-5871"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Gene == Gene Ec-02_002980 == * left end position: ** 3256555 * transcription direction: ** POSITIVE * right end position: ** 3263817 * centisome position: ** 49.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_002980 == |
− | * | + | * left end position: |
− | ** | + | ** 3256555 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3263817 |
− | * | + | * centisome position: |
− | ** | + | ** 49.88755 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0272_0016 | ||
+ | ** Esi0272_0016 | ||
+ | ** UGL2 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-12178]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***automated-name-match |
+ | * [[RXN-12270]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7646]] | ||
+ | * [[PWY-6572]] | ||
+ | * [[PWY-6827]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3256555}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3263817}} | |
− | + | {{#set: centisome position=49.88755 }} | |
− | + | {{#set: common name=Esi_0272_0016|Esi0272_0016|UGL2}} | |
− | + | {{#set: reaction associated=RXN-12178|RXN-12270}} | |
− | + | {{#set: pathway associated=PWY-7646|PWY-6572|PWY-6827}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:43, 17 March 2018
Gene Ec-02_002980
- left end position:
- 3256555
- transcription direction:
- POSITIVE
- right end position:
- 3263817
- centisome position:
- 49.88755
- Synonym(s):
- Esi_0272_0016
- Esi0272_0016
- UGL2
Reactions associated
- RXN-12178
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-12270
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome