Difference between revisions of "RXN-5581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] == * direction: ** LEFT-TO-RIGHT * common name: ** Histidinol dehydrogenase ** A...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8001 RXN-8001] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
 
* common name:
 
* common name:
−
** Histidinol dehydrogenase
+
** 6-trans-tridecenoyl-CoA
−
** Aldehyde/histidinol dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 957.819   
−
** [http://enzyme.expasy.org/EC/1.1.1.23 EC-1.1.1.23]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 6E-tridecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14785]]
−
** 1 [[WATER]][c] '''+''' 2 [[NAD]][c] '''+''' 1 [[HISTIDINOL]][c] '''=>''' 2 [[NADH]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[HIS]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 2 NAD+[c] '''+''' 1 histidinol[c] '''=>''' 2 NADH[c] '''+''' 3 H+[c] '''+''' 1 L-histidine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-16_001760]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-20_001280]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20641 20641]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
−
* LIGAND-RXN:
+
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01158 R01158]
+
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=6-trans-tridecenoyl-CoA}}
−
{{#set: common name=Histidinol dehydrogenase}}
+
{{#set: molecular weight=957.819    }}
−
{{#set: common name=Aldehyde/histidinol dehydrogenase}}
+
{{#set: common name=6E-tridecenoyl-CoA}}
−
{{#set: ec number=EC-1.1.1.23}}
+
{{#set: consumed by=RXN-14785}}
−
{{#set: gene associated=Ec-16_001760|Ec-20_001280}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:43, 17 March 2018

Metabolite CPD-15651

  • smiles:
    • CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
  • common name:
    • 6-trans-tridecenoyl-CoA
  • molecular weight:
    • 957.819
  • Synonym(s):
    • 6E-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-5581&oldid=10082"