Difference between revisions of "PSERPHOSPHA-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5782 TAX-57...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5782 TAX-5782]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-10239 TAX-10239]
−
** InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
−
** 4-(2-aminophenyl)-2,4-dioxobutanoate
+
** pyrimidine deoxyribonucleotides de novo biosynthesis III
−
* molecular weight:
+
−
** 206.177   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10720]]
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[CDPREDUCT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 7 associated gene(s):
−
* [[2.6.1.7-RXN]]
+
*** [[Ec-06_005120]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-06_005570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DCDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-11_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-07_000140]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-20_004950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DUDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-26_003930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DUTP-PYROP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-13_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-12195]]
 +
** 9 associated gene(s):
 +
*** [[Ec-02_005730]]
 +
*** [[Ec-03_001180]]
 +
*** [[Ec-05_005340]]
 +
*** [[Ec-18_004660]]
 +
*** [[Ec-06_005470]]
 +
*** [[Ec-01_003690]]
 +
*** [[Ec-17_000870]]
 +
*** [[Ec-28_000420]]
 +
*** [[Ec-03_004860]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UDPREDUCT-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-06_005120]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-11_002170]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8850 RXN-8850]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-MAP:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615302 23615302]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00240 map00240]
−
* HMDB : HMDB00978
+
{{#set: taxonomic range=TAX-5782}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-10239}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01252 C01252]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.chemspider.com/Chemical-Structure.19951260.html 19951260]
+
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis III}}
−
* CHEBI:
+
{{#set: reaction found=8}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58147 58147]
+
{{#set: total reaction=9}}
−
* METABOLIGHTS : MTBLC58147
+
{{#set: completion rate=89.0}}
−
{{#set: smiles=C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=CAOVWYZQMPNAFJ-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
+
−
{{#set: molecular weight=206.177    }}
+
−
{{#set: consumed by=RXN-10720}}
+
−
{{#set: consumed or produced by=2.6.1.7-RXN}}
+

Revision as of 20:43, 17 March 2018

Pathway PWY-6545

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PSERPHOSPHA-RXN&oldid=10101"