Difference between revisions of "Ec-07 003830"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5581 RXN-5581] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase [NAD(P...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5581 RXN-5581] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
+
 
* common name:
 
* common name:
** 6-trans-tridecenoyl-CoA
+
** aldehyde dehydrogenase [NAD(P)+]
* molecular weight:
+
* ec number:
** 957.819   
+
** [http://enzyme.expasy.org/EC/1.2.1.5 EC-1.2.1.5]
 
* Synonym(s):
 
* Synonym(s):
** 6E-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14785]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[INDOLE_ACETALDEHYDE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[INDOLE_ACETATE_AUXIN]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 indole acetaldehyde[c] '''+''' 1 NAD(P)+[c] '''+''' 1 H2O[c] '''=>''' 1 indole-3-acetate[c] '''+''' 1 NAD(P)H[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-11_002450]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
== Pathways  ==
 +
* [[PWY-3162]], L-tryptophan degradation V (side chain pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162]
 +
** '''1''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30867 30867]
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
+
{{#set: common name=aldehyde dehydrogenase [NAD(P)+]}}
{{#set: common name=6-trans-tridecenoyl-CoA}}
+
{{#set: ec number=EC-1.2.1.5}}
{{#set: molecular weight=957.819    }}
+
{{#set: gene associated=Ec-11_002450}}
{{#set: common name=6E-tridecenoyl-CoA}}
+
{{#set: in pathway=PWY-3162}}
{{#set: consumed by=RXN-14785}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 20:44, 17 March 2018

Reaction RXN-5581

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aldehyde dehydrogenase [NAD(P)+]
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3162, L-tryptophan degradation V (side chain pathway): PWY-3162
    • 1 reactions found over 13 reactions in the full pathway

Reconstruction information

External links

"aldehyde dehydrogenase [NAD(P)+" cannot be used as a page name in this wiki.