Difference between revisions of "LIOTHYRONINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == * smiles: ** CCCCCC=CCC(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O |
* common name: | * common name: | ||
| − | ** | + | ** L-arginine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 175.21 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-amino-5-guanidinovaleric acid |
| + | ** R | ||
| + | ** arginine | ||
| + | ** arg | ||
| + | ** L-arg | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ARGININE--TRNA-LIGASE-RXN]] | ||
| + | * [[biomass_rxn]] | ||
| + | * [[ARGININE-2-MONOOXYGENASE-RXN]] | ||
| + | * [[1.5.1.19-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
| + | * [[ARGINASE-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 74-79-3 |
| + | * BIGG : 33707 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549073 1549073] |
| − | * HMDB : | + | * HMDB : HMDB00517 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00062 C00062] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1266045.html 1266045] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32682 32682] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC32682 |
| − | {{#set: smiles= | + | {{#set: smiles=C(NC(N)=[N+])CCC([N+])C(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O}} |
| − | {{#set: common name= | + | {{#set: common name=L-arginine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=175.21 }} |
| − | {{#set: common name= | + | {{#set: common name=2-amino-5-guanidinovaleric acid|R|arginine|arg|L-arg}} |
| − | {{#set: | + | {{#set: consumed by=ARGININE--TRNA-LIGASE-RXN|biomass_rxn|ARGININE-2-MONOOXYGENASE-RXN|1.5.1.19-RXN}} |
| + | {{#set: reversible reaction associated=ARGSUCCINLYA-RXN|ARGINASE-RXN}} | ||
Revision as of 20:44, 17 March 2018
Contents
Metabolite ARG
- smiles:
- C(NC(N)=[N+])CCC([N+])C(=O)[O-]
- inchi key:
- InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O
- common name:
- L-arginine
- molecular weight:
- 175.21
- Synonym(s):
- 2-amino-5-guanidinovaleric acid
- R
- arginine
- arg
- L-arg
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 74-79-3
- BIGG : 33707
- PUBCHEM:
- HMDB : HMDB00517
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32682
"C(NC(N)=[N+])CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
