Difference between revisions of "GLUTSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
 
(Created page with "Category:Gene == Gene Ec-26_002430 == * left end position: ** 2752576 * transcription direction: ** NEGATIVE * right end position: ** 2757827 * centisome position: ** 41.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
+
== Gene Ec-26_002430 ==
−
* smiles:
+
* left end position:
−
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
+
** 2752576
−
* inchi key:
+
* transcription direction:
−
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** 2757827
−
* molecular weight:
+
* centisome position:
−
** 296.358    
+
** 41.811188    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
+
** Esi_0212_0023
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0212_0023
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
−
* [[RXN-15684]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7765]]
 +
* [[PWY-5651]]
 +
* [[PWY-6309]]
 +
* [[PWY-7717]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2752576}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
+
{{#set: right end position=2757827}}
−
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
+
{{#set: centisome position=41.811188   }}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0212_0023|Esi0212_0023}}
−
{{#set: molecular weight=296.358   }}
+
{{#set: reaction associated=KYNURENINE-3-MONOOXYGENASE-RXN}}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: pathway associated=PWY-7765|PWY-5651|PWY-6309|PWY-7717}}
−
{{#set: produced by=RXN-15684}}
+

Revision as of 20:46, 17 March 2018

Gene Ec-26_002430

  • left end position:
    • 2752576
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2757827
  • centisome position:
    • 41.811188
  • Synonym(s):
    • Esi_0212_0023
    • Esi0212_0023

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLUTSYN-PWY&oldid=10281"