Difference between revisions of "RXN0-5245"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_001380 == * left end position: ** 1612953 * transcription direction: ** NEGATIVE * right end position: ** 1622108 * centisome position: ** 24.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(O)C(O)C(O)CO |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N |
| − | * | + | * common name: |
| − | ** | + | ** ribitol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 152.147 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** meso-ribitol |
| − | ** | + | ** adonitol |
| + | ** (2R,3s,4S)-pentane-1,2,3,4,5-pentol | ||
| + | ** D-ribitol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 488-81-3 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963] |
| − | + | * METABOLIGHTS : MTBLC15963 | |
| − | {{#set: | + | * HMDB : HMDB00508 |
| + | {{#set: smiles=C(O)C(O)C(O)C(O)CO}} | ||
| + | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}} | ||
| + | {{#set: common name=ribitol}} | ||
| + | {{#set: molecular weight=152.147 }} | ||
| + | {{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}} | ||
| + | {{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}} | ||
Revision as of 20:46, 17 March 2018
Contents
Metabolite RIBITOL
- smiles:
- C(O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
- common name:
- ribitol
- molecular weight:
- 152.147
- Synonym(s):
- meso-ribitol
- adonitol
- (2R,3s,4S)-pentane-1,2,3,4,5-pentol
- D-ribitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
